C20H19ClN2O2 — CID 100513460
2-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N,N-diethylbenzamide (PubChem CID 100513460) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N,N-diethylbenzamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 100513460 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1-c1ncc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-3-23(4-2)20(24)17-8-6-5-7-16(17)19-22-13-18(25-19)14-9-11-15(21)12-10-14/h5-13H,3-4H2,1-2H3 |
| InChIKey | BFIJFNZITWKAKX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |