C22H22N2O2 — CID 86939454
N-(cyclopropylmethyl)-N-ethyl-2-(5-phenyl-1,3-oxazol-2-yl)benzamide (PubChem CID 86939454) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-ethyl-2-(5-phenyl-1,3-oxazol-2-yl)benzamide.
| Compound Name | N-(cyclopropylmethyl)-N-ethyl-2-(5-phenyl-1,3-oxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 86939454 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-(cyclopropylmethyl)-N-ethyl-2-(5-phenyl-1,3-oxazol-2-yl)benzamide |
| SMILES | CCN(CC1CC1)C(=O)c1ccccc1-c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C22H22N2O2/c1-2-24(15-16-12-13-16)22(25)19-11-7-6-10-18(19)21-23-14-20(26-21)17-8-4-3-5-9-17/h3-11,14,16H,2,12-13,15H2,1H3 |
| InChIKey | HJJZGILCOCNWBV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |