C26H34IN3O5S — CID 100514041
(2S)-N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 100514041) has the molecular formula C26H34IN3O5S and a molecular weight of 627.55 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 100514041 |
| Molecular Formula | C26H34IN3O5S |
| Molecular Weight | 627.55 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | COc1ccc(CN(C(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)[C@@H](C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H34IN3O5S/c1-19(26(32)28-22-7-5-4-6-8-22)29(17-20-9-15-24(35-2)16-10-20)25(31)18-30(36(3,33)34)23-13-11-21(27)12-14-23/h9-16,19,22H,4-8,17-18H2,1-3H3,(H,28,32)/t19-/m0/s1 |
| InChIKey | WYXPXKNSAJMFPY-IBGZPJMESA-N |
| XLogP | 3.93 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|