C26H35N3O5S — CID 132619617
2-[benzyl-[2-(4-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 132619617) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-[benzyl-[2-(4-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[benzyl-[2-(4-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 132619617 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 2-[benzyl-[2-(4-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2ccccc2)C(C)C(=O)NC2CCCCC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H35N3O5S/c1-20(26(31)27-22-12-8-5-9-13-22)28(18-21-10-6-4-7-11-21)25(30)19-29(35(3,32)33)23-14-16-24(34-2)17-15-23/h4,6-7,10-11,14-17,20,22H,5,8-9,12-13,18-19H2,1-3H3,(H,27,31) |
| InChIKey | GWXLWFILCUDJHN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |