C25H20ClFN4OS — CID 100514078
(4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(3-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100514078) has the molecular formula C25H20ClFN4OS and a molecular weight of 478.98 g/mol. Its IUPAC name is (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(3-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(3-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100514078 |
| Molecular Formula | C25H20ClFN4OS |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | (4R,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(3-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2cccn2-c2cccc(F)c2)cc1Cl |
| InChI | InChI=1S/C25H20ClFN4OS/c1-32-22-11-10-18(15-19(22)26)31-24(23(29-25(31)33)20-8-2-3-12-28-20)21-9-5-13-30(21)17-7-4-6-16(27)14-17/h2-15,23-24H,1H3,(H,29,33)/t23-,24+/m0/s1 |
| InChIKey | VMWFNUOAEZHZQV-BJKOFHAPSA-N |
| XLogP | 5.85 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|