C25H19Cl3N4OS — CID 100511416
(4R,5R)-1-(3-chloro-4-methoxyphenyl)-5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100511416) has the molecular formula C25H19Cl3N4OS and a molecular weight of 529.88 g/mol. Its IUPAC name is (4R,5R)-1-(3-chloro-4-methoxyphenyl)-5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(3-chloro-4-methoxyphenyl)-5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100511416 |
| Molecular Formula | C25H19Cl3N4OS |
| Molecular Weight | 529.88 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | (4R,5R)-1-(3-chloro-4-methoxyphenyl)-5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2cccn2-c2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C25H19Cl3N4OS/c1-33-22-10-8-16(14-18(22)28)32-24(23(30-25(32)34)19-5-2-3-11-29-19)21-6-4-12-31(21)20-9-7-15(26)13-17(20)27/h2-14,23-24H,1H3,(H,30,34)/t23-,24-/m0/s1 |
| InChIKey | IVMLHHLBEUJZAU-ZEQRLZLVSA-N |
| XLogP | 7.02 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.88 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|