C25H20Cl2N4OS — CID 133182855
5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-1-(3-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182855) has the molecular formula C25H20Cl2N4OS and a molecular weight of 495.44 g/mol. Its IUPAC name is 5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-1-(3-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-1-(3-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182855 |
| Molecular Formula | C25H20Cl2N4OS |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-1-(3-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C25H20Cl2N4OS/c1-32-18-7-4-6-17(15-18)31-24(23(29-25(31)33)20-8-2-3-12-28-20)22-9-5-13-30(22)21-11-10-16(26)14-19(21)27/h2-15,23-24H,1H3,(H,29,33) |
| InChIKey | UQODXJQLNZUAON-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|