C25H18Cl2N4O2S — CID 133156981
1-(1,3-benzodioxol-5-yl)-5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156981) has the molecular formula C25H18Cl2N4O2S and a molecular weight of 509.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156981 |
| Molecular Formula | C25H18Cl2N4O2S |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-[1-(2,4-dichlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2cccn2-c2ccc(Cl)cc2Cl)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H18Cl2N4O2S/c26-15-6-8-19(17(27)12-15)30-11-3-5-20(30)24-23(18-4-1-2-10-28-18)29-25(34)31(24)16-7-9-21-22(13-16)33-14-32-21/h1-13,23-24H,14H2,(H,29,34) |
| InChIKey | IBNZGTCZUQIWFA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|