C20H18INO — CID 100514262
3-iodo-N-(3-naphthalen-1-ylpropyl)benzamide (PubChem CID 100514262) has the molecular formula C20H18INO and a molecular weight of 415.27 g/mol. Its IUPAC name is 3-iodo-N-(3-naphthalen-1-ylpropyl)benzamide.
| Compound Name | 3-iodo-N-(3-naphthalen-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 100514262 |
| Molecular Formula | C20H18INO |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 3-iodo-N-(3-naphthalen-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCc1cccc2ccccc12)c1cccc(I)c1 |
| InChI | InChI=1S/C20H18INO/c21-18-11-4-9-17(14-18)20(23)22-13-5-10-16-8-3-7-15-6-1-2-12-19(15)16/h1-4,6-9,11-12,14H,5,10,13H2,(H,22,23) |
| InChIKey | OWVFZVWOCLZINL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|