C18H18FNO2 — CID 100514728
3-(4-fluorophenyl)-N-(4-prop-2-enoxyphenyl)propanamide (PubChem CID 100514728) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(4-prop-2-enoxyphenyl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-(4-prop-2-enoxyphenyl)propanamide |
|---|---|
| PubChem CID | 100514728 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(4-prop-2-enoxyphenyl)propanamide |
| SMILES | C=CCOc1ccc(NC(=O)CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H18FNO2/c1-2-13-22-17-10-8-16(9-11-17)20-18(21)12-5-14-3-6-15(19)7-4-14/h2-4,6-11H,1,5,12-13H2,(H,20,21) |
| InChIKey | MJFZONNGFVTITL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|