C24H33N3O3S — CID 100515418
(2S)-2-(2,5-dimethyl-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)butanamide (PubChem CID 100515418) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethyl-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)butanamide.
| Compound Name | (2S)-2-(2,5-dimethyl-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 100515418 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (2S)-2-(2,5-dimethyl-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)butanamide |
| SMILES | CC[C@@H](C(=O)Nc1ccc(N2CCCCC2)cc1)N(c1cc(C)ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C24H33N3O3S/c1-5-22(27(31(4,29)30)23-17-18(2)9-10-19(23)3)24(28)25-20-11-13-21(14-12-20)26-15-7-6-8-16-26/h9-14,17,22H,5-8,15-16H2,1-4H3,(H,25,28)/t22-/m0/s1 |
| InChIKey | ZPMWBIKGWQTTQY-QFIPXVFZSA-N |
| XLogP | 4.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|