C23H30ClN3O3S — CID 100515628
(2R)-2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)butanamide (PubChem CID 100515628) has the molecular formula C23H30ClN3O3S and a molecular weight of 464.03 g/mol. Its IUPAC name is (2R)-2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)butanamide.
| Compound Name | (2R)-2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 100515628 |
| Molecular Formula | C23H30ClN3O3S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2R)-2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)butanamide |
| SMILES | CC[C@H](C(=O)Nc1ccc(N2CCCCC2)cc1)N(c1ccc(C)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H30ClN3O3S/c1-4-22(27(31(3,29)30)20-11-8-17(2)21(24)16-20)23(28)25-18-9-12-19(13-10-18)26-14-6-5-7-15-26/h8-13,16,22H,4-7,14-15H2,1-3H3,(H,25,28)/t22-/m1/s1 |
| InChIKey | SUISTCPQBJHGCB-JOCHJYFZSA-N |
| XLogP | 4.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|