C19H20ClF3N2O3S — CID 132674566
2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 132674566) has the molecular formula C19H20ClF3N2O3S and a molecular weight of 448.89 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 132674566 |
| Molecular Formula | C19H20ClF3N2O3S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCC(C(=O)Nc1ccc(C(F)(F)F)cc1)N(c1ccc(C)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H20ClF3N2O3S/c1-4-17(18(26)24-14-8-6-13(7-9-14)19(21,22)23)25(29(3,27)28)15-10-5-12(2)16(20)11-15/h5-11,17H,4H2,1-3H3,(H,24,26) |
| InChIKey | ZJCXZFMCSPLLMA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |