C21H25Cl2N3O3S — CID 133166888
2-(3,4-dichloro-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 133166888) has the molecular formula C21H25Cl2N3O3S and a molecular weight of 470.42 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 133166888 |
| Molecular Formula | C21H25Cl2N3O3S |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(N2CCCCC2)cc1)N(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C21H25Cl2N3O3S/c1-15(26(30(2,28)29)18-10-11-19(22)20(23)14-18)21(27)24-16-6-8-17(9-7-16)25-12-4-3-5-13-25/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,24,27) |
| InChIKey | DSPBFZWRNRNLIW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|