C20H23Cl2N3O3S — CID 100503371
(2S)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 100503371) has the molecular formula C20H23Cl2N3O3S and a molecular weight of 456.40 g/mol. Its IUPAC name is (2S)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | (2S)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 100503371 |
| Molecular Formula | C20H23Cl2N3O3S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | (2S)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(N2CCCC2)cc1)N(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C20H23Cl2N3O3S/c1-14(25(29(2,27)28)19-13-15(21)5-10-18(19)22)20(26)23-16-6-8-17(9-7-16)24-11-3-4-12-24/h5-10,13-14H,3-4,11-12H2,1-2H3,(H,23,26)/t14-/m0/s1 |
| InChIKey | XRASQGTYUJUSAK-AWEZNQCLSA-N |
| XLogP | 4.39 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|