C22H29N3O3S — CID 100502761
(2S)-2-(3,5-dimethyl-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 100502761) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethyl-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | (2S)-2-(3,5-dimethyl-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 100502761 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (2S)-2-(3,5-dimethyl-N-methylsulfonylanilino)-N-(4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | Cc1cc(C)cc(N([C@@H](C)C(=O)Nc2ccc(N3CCCC3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H29N3O3S/c1-16-13-17(2)15-21(14-16)25(29(4,27)28)18(3)22(26)23-19-7-9-20(10-8-19)24-11-5-6-12-24/h7-10,13-15,18H,5-6,11-12H2,1-4H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | ISHHLLRUTIWHQZ-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|