C24H26Cl3NO3S — CID 10052204
(E)-3-[3-chloro-4-(2,4-dichlorophenyl)sulfanylphenyl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 10052204) has the molecular formula C24H26Cl3NO3S and a molecular weight of 514.90 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(2,4-dichlorophenyl)sulfanylphenyl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[3-chloro-4-(2,4-dichlorophenyl)sulfanylphenyl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10052204 |
| Molecular Formula | C24H26Cl3NO3S |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | (E)-3-[3-chloro-4-(2,4-dichlorophenyl)sulfanylphenyl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Sc2ccc(Cl)cc2Cl)c(Cl)c1)N1CCC(CCOCCO)CC1 |
| InChI | InChI=1S/C24H26Cl3NO3S/c25-19-3-5-23(21(27)16-19)32-22-4-1-18(15-20(22)26)2-6-24(30)28-10-7-17(8-11-28)9-13-31-14-12-29/h1-6,15-17,29H,7-14H2/b6-2+ |
| InChIKey | WSSUMKNYQLKSGU-QHHAFSJGSA-N |
| XLogP | 6.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|