C31H35Cl2N3O4S — CID 100523433
(2R)-2-[[2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide (PubChem CID 100523433) has the molecular formula C31H35Cl2N3O4S and a molecular weight of 616.61 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100523433 |
| Molecular Formula | C31H35Cl2N3O4S |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-2,3-dichloroanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H35Cl2N3O4S/c1-2-27(31(38)34-24-15-8-4-9-16-24)35(21-23-13-6-3-7-14-23)29(37)22-36(28-20-12-19-26(32)30(28)33)41(39,40)25-17-10-5-11-18-25/h3,5-7,10-14,17-20,24,27H,2,4,8-9,15-16,21-22H2,1H3,(H,34,38)/t27-/m1/s1 |
| InChIKey | WQTGMZCAWUUIEP-HHHXNRCGSA-N |
| XLogP | 6.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |