C31H35Cl2N3O4S — CID 132638518
2-[[2-[N-(benzenesulfonyl)-2,4-dichloroanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide (PubChem CID 132638518) has the molecular formula C31H35Cl2N3O4S and a molecular weight of 616.61 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2,4-dichloroanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2,4-dichloroanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132638518 |
| Molecular Formula | C31H35Cl2N3O4S |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2,4-dichloroanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H35Cl2N3O4S/c1-2-28(31(38)34-25-14-8-4-9-15-25)35(21-23-12-6-3-7-13-23)30(37)22-36(29-19-18-24(32)20-27(29)33)41(39,40)26-16-10-5-11-17-26/h3,5-7,10-13,16-20,25,28H,2,4,8-9,14-15,21-22H2,1H3,(H,34,38) |
| InChIKey | KIKZYTFRFULMDM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |