C29H40N2O3 — CID 100528386
(2S)-2-[benzyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 100528386) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is (2S)-2-[benzyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[benzyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100528386 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (2S)-2-[benzyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C29H40N2O3/c1-5-25(28(33)30-23-16-10-7-11-17-23)31(20-22-14-8-6-9-15-22)27(32)21-34-26-19-13-12-18-24(26)29(2,3)4/h6,8-9,12-15,18-19,23,25H,5,7,10-11,16-17,20-21H2,1-4H3,(H,30,33)/t25-/m0/s1 |
| InChIKey | IPAKKRNFBVVCDR-VWLOTQADSA-N |
| XLogP | 5.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |