C34H42N2O3 — CID 100575908
(2S)-2-[benzyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 100575908) has the molecular formula C34H42N2O3 and a molecular weight of 526.72 g/mol. Its IUPAC name is (2S)-2-[benzyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[benzyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100575908 |
| Molecular Formula | C34H42N2O3 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | (2S)-2-[benzyl-[2-(2-tert-butylphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)N(Cc1ccccc1)[C@@H](Cc1ccccc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C34H42N2O3/c1-34(2,3)29-21-13-14-22-31(29)39-25-32(37)36(24-27-17-9-5-10-18-27)30(23-26-15-7-4-8-16-26)33(38)35-28-19-11-6-12-20-28/h4-5,7-10,13-18,21-22,28,30H,6,11-12,19-20,23-25H2,1-3H3,(H,35,38)/t30-/m0/s1 |
| InChIKey | YRJNFXLUJMGUNM-PMERELPUSA-N |
| XLogP | 6.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |