C33H32Cl2N4O6S — CID 100529930
(2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 100529930) has the molecular formula C33H32Cl2N4O6S and a molecular weight of 683.61 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100529930 |
| Molecular Formula | C33H32Cl2N4O6S |
| Molecular Weight | 683.61 g/mol |
| Exact Mass | 682.14 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H32Cl2N4O6S/c1-23(2)36-33(41)31(19-24-9-5-3-6-10-24)37(21-25-13-14-26(34)20-30(25)35)32(40)22-38(27-15-17-28(18-16-27)39(42)43)46(44,45)29-11-7-4-8-12-29/h3-18,20,23,31H,19,21-22H2,1-2H3,(H,36,41)/t31-/m1/s1 |
| InChIKey | ZOBJNNBDWDHAGH-WJOKGBTCSA-N |
| XLogP | 6.26 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|