C27H28Cl2N4O6S — CID 100692561
(2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-propan-2-ylpropanamide (PubChem CID 100692561) has the molecular formula C27H28Cl2N4O6S and a molecular weight of 607.52 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100692561 |
| Molecular Formula | C27H28Cl2N4O6S |
| Molecular Weight | 607.52 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@H](C)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28Cl2N4O6S/c1-18(2)30-27(35)19(3)31(16-20-9-10-21(28)15-25(20)29)26(34)17-32(22-11-13-23(14-12-22)33(36)37)40(38,39)24-7-5-4-6-8-24/h4-15,18-19H,16-17H2,1-3H3,(H,30,35)/t19-/m0/s1 |
| InChIKey | OINCMGDNBNYTGG-IBGZPJMESA-N |
| XLogP | 5.04 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|