C20H40N5O8PS — CID 10053059
2-amino-5-[[3-[2-[bis(diethylamino)phosphoryloxy]ethylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 10053059) has the molecular formula C20H40N5O8PS and a molecular weight of 541.61 g/mol. Its IUPAC name is 2-amino-5-[[3-[2-[bis(diethylamino)phosphoryloxy]ethylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[3-[2-[bis(diethylamino)phosphoryloxy]ethylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10053059 |
| Molecular Formula | C20H40N5O8PS |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 2-amino-5-[[3-[2-[bis(diethylamino)phosphoryloxy]ethylsulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCN(CC)P(=O)(OCCSCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)N(CC)CC |
| InChI | InChI=1S/C20H40N5O8PS/c1-5-24(6-2)34(32,25(7-3)8-4)33-11-12-35-14-16(19(29)22-13-18(27)28)23-17(26)10-9-15(21)20(30)31/h15-16H,5-14,21H2,1-4H3,(H,22,29)(H,23,26)(H,27,28)(H,30,31) |
| InChIKey | ZYXNGLDQKDFQQV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|