C32H38IN3O4S — CID 100532313
(2S)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 100532313) has the molecular formula C32H38IN3O4S and a molecular weight of 687.64 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100532313 |
| Molecular Formula | C32H38IN3O4S |
| Molecular Weight | 687.64 g/mol |
| Exact Mass | 687.16 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1C)C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H38IN3O4S/c1-3-30(32(38)34-27-14-6-4-7-15-27)35(22-25-13-11-10-12-24(25)2)31(37)23-36(28-20-18-26(33)19-21-28)41(39,40)29-16-8-5-9-17-29/h5,8-13,16-21,27,30H,3-4,6-7,14-15,22-23H2,1-2H3,(H,34,38)/t30-/m0/s1 |
| InChIKey | RFBWQERHCKQZTO-PMERELPUSA-N |
| XLogP | 6.05 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|