C23H30N2O2S — CID 100536693
(2R)-2-[benzyl-(2-benzylsulfanylacetyl)amino]-N-propylbutanamide (PubChem CID 100536693) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is (2R)-2-[benzyl-(2-benzylsulfanylacetyl)amino]-N-propylbutanamide.
| Compound Name | (2R)-2-[benzyl-(2-benzylsulfanylacetyl)amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100536693 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (2R)-2-[benzyl-(2-benzylsulfanylacetyl)amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@@H](CC)N(Cc1ccccc1)C(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O2S/c1-3-15-24-23(27)21(4-2)25(16-19-11-7-5-8-12-19)22(26)18-28-17-20-13-9-6-10-14-20/h5-14,21H,3-4,15-18H2,1-2H3,(H,24,27)/t21-/m1/s1 |
| InChIKey | HBQIILVPIMVDNG-OAQYLSRUSA-N |
| XLogP | 4.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |