C28H29ClN2O7S — CID 10053816
2-[6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-2,4-dioxooxan-3-yl]sulfanyl-3H-benzimidazole-5-carboxylic acid (PubChem CID 10053816) has the molecular formula C28H29ClN2O7S and a molecular weight of 573.07 g/mol. Its IUPAC name is 2-[6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-2,4-dioxooxan-3-yl]sulfanyl-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-2,4-dioxooxan-3-yl]sulfanyl-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 10053816 |
| Molecular Formula | C28H29ClN2O7S |
| Molecular Weight | 573.07 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 2-[6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-2,4-dioxooxan-3-yl]sulfanyl-3H-benzimidazole-5-carboxylic acid |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3nc4ccc(C(=O)O)cc4[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C28H29ClN2O7S/c1-36-22-13-23(37-2)18(29)11-15(22)9-10-28(17-5-3-4-6-17)14-21(32)24(26(35)38-28)39-27-30-19-8-7-16(25(33)34)12-20(19)31-27/h7-8,11-13,17,24H,3-6,9-10,14H2,1-2H3,(H,30,31)(H,33,34) |
| InChIKey | AEWQLKRCVJBSHE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 127.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.07 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|