C28H30Cl2N2O5S — CID 11387617
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-3-(5-chloro-1-methylbenzimidazol-2-yl)sulfanyl-6-cyclopentyloxane-2,4-dione (PubChem CID 11387617) has the molecular formula C28H30Cl2N2O5S and a molecular weight of 577.53 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-3-(5-chloro-1-methylbenzimidazol-2-yl)sulfanyl-6-cyclopentyloxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-3-(5-chloro-1-methylbenzimidazol-2-yl)sulfanyl-6-cyclopentyloxane-2,4-dione |
|---|---|
| PubChem CID | 11387617 |
| Molecular Formula | C28H30Cl2N2O5S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-3-(5-chloro-1-methylbenzimidazol-2-yl)sulfanyl-6-cyclopentyloxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3nc4cc(Cl)ccc4n3C)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C28H30Cl2N2O5S/c1-32-21-9-8-18(29)13-20(21)31-27(32)38-25-22(33)15-28(37-26(25)34,17-6-4-5-7-17)11-10-16-12-19(30)24(36-3)14-23(16)35-2/h8-9,12-14,17,25H,4-7,10-11,15H2,1-3H3 |
| InChIKey | RQCKVSPVRGLTEV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|