C26H25Cl2FN2O4S — CID 91074545
3-[(5-chloro-6-fluoro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione (PubChem CID 91074545) has the molecular formula C26H25Cl2FN2O4S and a molecular weight of 551.47 g/mol. Its IUPAC name is 3-[(5-chloro-6-fluoro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione.
| Compound Name | 3-[(5-chloro-6-fluoro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
|---|---|
| PubChem CID | 91074545 |
| Molecular Formula | C26H25Cl2FN2O4S |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 3-[(5-chloro-6-fluoro-1H-benzimidazol-2-yl)sulfanyl]-6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nc4cc(Cl)c(F)cc4[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C26H25Cl2FN2O4S/c1-34-22-7-6-14(10-17(22)28)8-9-26(15-4-2-3-5-15)13-21(32)23(24(33)35-26)36-25-30-19-11-16(27)18(29)12-20(19)31-25/h6-7,10-12,15,23H,2-5,8-9,13H2,1H3,(H,30,31) |
| InChIKey | CYFGAMFOYUTCPG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|