C27H28Cl2N2O4S — CID 11249793
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-3-(5-chloro-1-methylbenzimidazol-2-yl)sulfanyl-6-cyclopentyloxane-2,4-dione (PubChem CID 11249793) has the molecular formula C27H28Cl2N2O4S and a molecular weight of 547.50 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-3-(5-chloro-1-methylbenzimidazol-2-yl)sulfanyl-6-cyclopentyloxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-3-(5-chloro-1-methylbenzimidazol-2-yl)sulfanyl-6-cyclopentyloxane-2,4-dione |
|---|---|
| PubChem CID | 11249793 |
| Molecular Formula | C27H28Cl2N2O4S |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-3-(5-chloro-1-methylbenzimidazol-2-yl)sulfanyl-6-cyclopentyloxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nc4cc(Cl)ccc4n3C)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C27H28Cl2N2O4S/c1-31-21-9-8-18(28)14-20(21)30-26(31)36-24-22(32)15-27(35-25(24)33,17-5-3-4-6-17)12-11-16-7-10-23(34-2)19(29)13-16/h7-10,13-14,17,24H,3-6,11-12,15H2,1-2H3 |
| InChIKey | OJMSKEOAXYDPDI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|