C21H26BrNO2 — CID 100539021
2-(4-bromo-3,5-dimethylphenoxy)-N-[(2,5-diethylphenyl)methyl]acetamide (PubChem CID 100539021) has the molecular formula C21H26BrNO2 and a molecular weight of 404.35 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenoxy)-N-[(2,5-diethylphenyl)methyl]acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylphenoxy)-N-[(2,5-diethylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 100539021 |
| Molecular Formula | C21H26BrNO2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenoxy)-N-[(2,5-diethylphenyl)methyl]acetamide |
| SMILES | CCc1ccc(CC)c(CNC(=O)COc2cc(C)c(Br)c(C)c2)c1 |
| InChI | InChI=1S/C21H26BrNO2/c1-5-16-7-8-17(6-2)18(11-16)12-23-20(24)13-25-19-9-14(3)21(22)15(4)10-19/h7-11H,5-6,12-13H2,1-4H3,(H,23,24) |
| InChIKey | LXAPFVRYOFSVJZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |