C22H28BrN3O2 — CID 99971728
2-(4-bromo-3,5-dimethylphenoxy)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]acetamide (PubChem CID 99971728) has the molecular formula C22H28BrN3O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenoxy)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylphenoxy)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 99971728 |
| Molecular Formula | C22H28BrN3O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenoxy)-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]acetamide |
| SMILES | Cc1cc(OCC(=O)NCc2ccc(N3CCN(C)CC3)cc2)cc(C)c1Br |
| InChI | InChI=1S/C22H28BrN3O2/c1-16-12-20(13-17(2)22(16)23)28-15-21(27)24-14-18-4-6-19(7-5-18)26-10-8-25(3)9-11-26/h4-7,12-13H,8-11,14-15H2,1-3H3,(H,24,27) |
| InChIKey | NQRVBNYZZZGOMH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|