C18H30N2O3S — CID 100539205
4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[(2S)-pentan-2-yl]butanamide (PubChem CID 100539205) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[(2S)-pentan-2-yl]butanamide.
| Compound Name | 4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[(2S)-pentan-2-yl]butanamide |
|---|---|
| PubChem CID | 100539205 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[(2S)-pentan-2-yl]butanamide |
| SMILES | CCC[C@H](C)NC(=O)CCCN(c1cc(C)cc(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H30N2O3S/c1-6-8-16(4)19-18(21)9-7-10-20(24(5,22)23)17-12-14(2)11-15(3)13-17/h11-13,16H,6-10H2,1-5H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | HEFLBHDIMDPUDS-INIZCTEOSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |