C14H21NO4S — CID 91671548
methyl 4-(3,5-dimethyl-N-methylsulfonylanilino)butanoate (PubChem CID 91671548) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is methyl 4-(3,5-dimethyl-N-methylsulfonylanilino)butanoate.
| Compound Name | methyl 4-(3,5-dimethyl-N-methylsulfonylanilino)butanoate |
|---|---|
| PubChem CID | 91671548 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl 4-(3,5-dimethyl-N-methylsulfonylanilino)butanoate |
| SMILES | COC(=O)CCCN(c1cc(C)cc(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C14H21NO4S/c1-11-8-12(2)10-13(9-11)15(20(4,17)18)7-5-6-14(16)19-3/h8-10H,5-7H2,1-4H3 |
| InChIKey | ZKGSJFYVUDQMMG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |