C22H31N3O3S — CID 53288361
N-[[4-(dimethylamino)phenyl]methyl]-4-(3,5-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 53288361) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-4-(3,5-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-4-(3,5-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 53288361 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-4-(3,5-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | Cc1cc(C)cc(N(CCCC(=O)NCc2ccc(N(C)C)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H31N3O3S/c1-17-13-18(2)15-21(14-17)25(29(5,27)28)12-6-7-22(26)23-16-19-8-10-20(11-9-19)24(3)4/h8-11,13-15H,6-7,12,16H2,1-5H3,(H,23,26) |
| InChIKey | NFMIWHGORSUYFP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|