C26H37N3O3S — CID 125058011
4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]butanamide (PubChem CID 125058011) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is 4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]butanamide.
| Compound Name | 4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 125058011 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 4-(3,5-dimethyl-N-methylsulfonylanilino)-N-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]butanamide |
| SMILES | Cc1cc(C)cc(N(CCCC(=O)NCc2ccc(N3CCC[C@H](C)C3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C26H37N3O3S/c1-20-7-5-13-28(19-20)24-11-9-23(10-12-24)18-27-26(30)8-6-14-29(33(4,31)32)25-16-21(2)15-22(3)17-25/h9-12,15-17,20H,5-8,13-14,18-19H2,1-4H3,(H,27,30)/t20-/m0/s1 |
| InChIKey | OEQSHGNKKRNCFK-FQEVSTJZSA-N |
| XLogP | 4.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|