C29H35N3O4S — CID 43897064
2-(N-(4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide (PubChem CID 43897064) has the molecular formula C29H35N3O4S and a molecular weight of 521.68 g/mol. Its IUPAC name is 2-(N-(4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-(N-(4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 43897064 |
| Molecular Formula | C29H35N3O4S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 2-(N-(4-methoxyphenyl)sulfonyl-4-methylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCc2ccc(N3CCCC(C)C3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H35N3O4S/c1-22-6-10-26(11-7-22)32(37(34,35)28-16-14-27(36-3)15-17-28)21-29(33)30-19-24-8-12-25(13-9-24)31-18-4-5-23(2)20-31/h6-17,23H,4-5,18-21H2,1-3H3,(H,30,33) |
| InChIKey | MKQSMTKNMSPWFL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|