C22H28IN3O3S — CID 43897366
2-(4-iodo-N-methylsulfonylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide (PubChem CID 43897366) has the molecular formula C22H28IN3O3S and a molecular weight of 541.46 g/mol. Its IUPAC name is 2-(4-iodo-N-methylsulfonylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 43897366 |
| Molecular Formula | C22H28IN3O3S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide |
| SMILES | CC1CCCN(c2ccc(CNC(=O)CN(c3ccc(I)cc3)S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C22H28IN3O3S/c1-17-4-3-13-25(15-17)20-9-5-18(6-10-20)14-24-22(27)16-26(30(2,28)29)21-11-7-19(23)8-12-21/h5-12,17H,3-4,13-16H2,1-2H3,(H,24,27) |
| InChIKey | UFUSJLVWKZZIIP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|