C19H29N3O3S — CID 113156284
N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-N-(4-pyrrolidin-1-ylphenyl)methanesulfonamide (PubChem CID 113156284) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-N-(4-pyrrolidin-1-ylphenyl)methanesulfonamide.
| Compound Name | N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-N-(4-pyrrolidin-1-ylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 113156284 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-N-(4-pyrrolidin-1-ylphenyl)methanesulfonamide |
| SMILES | CC1CCCN(C(=O)CN(c2ccc(N3CCCC3)cc2)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C19H29N3O3S/c1-16-6-5-13-21(14-16)19(23)15-22(26(2,24)25)18-9-7-17(8-10-18)20-11-3-4-12-20/h7-10,16H,3-6,11-15H2,1-2H3 |
| InChIKey | FLHMWTMHDYGRHI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|