C26H34N4O5S — CID 30272477
2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 30272477) has the molecular formula C26H34N4O5S and a molecular weight of 514.65 g/mol. Its IUPAC name is 2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30272477 |
| Molecular Formula | C26H34N4O5S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCc1ccc(N2CCCCC2)cc1)c1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H34N4O5S/c1-36(33,34)30(24-11-7-22(8-12-24)26(32)29-15-17-35-18-16-29)20-25(31)27-19-21-5-9-23(10-6-21)28-13-3-2-4-14-28/h5-12H,2-4,13-20H2,1H3,(H,27,31) |
| InChIKey | JLYYDTOSMWDAEE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|