C23H29N3O6S — CID 30273764
N-[(3-ethoxyphenyl)methyl]-2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]acetamide (PubChem CID 30273764) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[(3-ethoxyphenyl)methyl]-2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]acetamide.
| Compound Name | N-[(3-ethoxyphenyl)methyl]-2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 30273764 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-[(3-ethoxyphenyl)methyl]-2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]acetamide |
| SMILES | CCOc1cccc(CNC(=O)CN(c2ccc(C(=O)N3CCOCC3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H29N3O6S/c1-3-32-21-6-4-5-18(15-21)16-24-22(27)17-26(33(2,29)30)20-9-7-19(8-10-20)23(28)25-11-13-31-14-12-25/h4-10,15H,3,11-14,16-17H2,1-2H3,(H,24,27) |
| InChIKey | CFXJCNKRKFTPOP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |