C24H31N3O5S2 — CID 30266454
N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]-2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]acetamide (PubChem CID 30266454) has the molecular formula C24H31N3O5S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]-2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]acetamide.
| Compound Name | N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]-2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 30266454 |
| Molecular Formula | C24H31N3O5S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]-2-[N-methylsulfonyl-4-(morpholine-4-carbonyl)anilino]acetamide |
| SMILES | Cc1cccc(CSCCNC(=O)CN(c2ccc(C(=O)N3CCOCC3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H31N3O5S2/c1-19-4-3-5-20(16-19)18-33-15-10-25-23(28)17-27(34(2,30)31)22-8-6-21(7-9-22)24(29)26-11-13-32-14-12-26/h3-9,16H,10-15,17-18H2,1-2H3,(H,25,28) |
| InChIKey | HGEXEIXTHZUUAN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|