C24H31F2N3O3S — CID 125054389
4-(3,4-difluoro-N-methylsulfonylanilino)-N-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]butanamide (PubChem CID 125054389) has the molecular formula C24H31F2N3O3S and a molecular weight of 479.59 g/mol. Its IUPAC name is 4-(3,4-difluoro-N-methylsulfonylanilino)-N-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]butanamide.
| Compound Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 125054389 |
| Molecular Formula | C24H31F2N3O3S |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]butanamide |
| SMILES | C[C@H]1CCCN(c2ccc(CNC(=O)CCCN(c3ccc(F)c(F)c3)S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C24H31F2N3O3S/c1-18-5-3-13-28(17-18)20-9-7-19(8-10-20)16-27-24(30)6-4-14-29(33(2,31)32)21-11-12-22(25)23(26)15-21/h7-12,15,18H,3-6,13-14,16-17H2,1-2H3,(H,27,30)/t18-/m0/s1 |
| InChIKey | UDCFSHQQQXRFNI-SFHVURJKSA-N |
| XLogP | 4.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|