C20H22F2N2O — CID 35619171
3-(3,4-difluorophenyl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]propanamide (PubChem CID 35619171) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]propanamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 35619171 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[(4-pyrrolidin-1-ylphenyl)methyl]propanamide |
| SMILES | O=C(CCc1ccc(F)c(F)c1)NCc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H22F2N2O/c21-18-9-5-15(13-19(18)22)6-10-20(25)23-14-16-3-7-17(8-4-16)24-11-1-2-12-24/h3-5,7-9,13H,1-2,6,10-12,14H2,(H,23,25) |
| InChIKey | FJVSNLNYISTFIE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|