C21H25FN2OS — CID 92679367
2-[(4-fluorophenyl)methylsulfanyl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 92679367) has the molecular formula C21H25FN2OS and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 92679367 |
| Molecular Formula | C21H25FN2OS |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | O=C(CSCc1ccc(F)cc1)NCc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25FN2OS/c22-19-8-4-18(5-9-19)15-26-16-21(25)23-14-17-6-10-20(11-7-17)24-12-2-1-3-13-24/h4-11H,1-3,12-16H2,(H,23,25) |
| InChIKey | LRWARFNEJOAMNF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|