C23H29N3O5S — CID 43898689
2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide (PubChem CID 43898689) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 43898689 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide |
| SMILES | CC1CCCN(c2ccc(CNC(=O)CN(c3ccc4c(c3)OCO4)S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C23H29N3O5S/c1-17-4-3-11-25(14-17)19-7-5-18(6-8-19)13-24-23(27)15-26(32(2,28)29)20-9-10-21-22(12-20)31-16-30-21/h5-10,12,17H,3-4,11,13-16H2,1-2H3,(H,24,27) |
| InChIKey | TVZLUEQTBMPMQE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|