C28H32FN3O4S — CID 43898806
2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide (PubChem CID 43898806) has the molecular formula C28H32FN3O4S and a molecular weight of 525.65 g/mol. Its IUPAC name is 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 43898806 |
| Molecular Formula | C28H32FN3O4S |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCc2ccc(N3CCCC(C)C3)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H32FN3O4S/c1-21-4-3-17-31(19-21)24-9-5-22(6-10-24)18-30-28(33)20-32(25-11-7-23(29)8-12-25)37(34,35)27-15-13-26(36-2)14-16-27/h5-16,21H,3-4,17-20H2,1-2H3,(H,30,33) |
| InChIKey | UGOXZGOHXDMBFP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|