C20H18N4O4S3 — CID 100541054
4-(2,5-dioxopyrrolidin-1-yl)-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzenesulfonamide (PubChem CID 100541054) has the molecular formula C20H18N4O4S3 and a molecular weight of 474.59 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 100541054 |
| Molecular Formula | C20H18N4O4S3 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| SMILES | Cc1cccc(CSc2nnc(NS(=O)(=O)c3ccc(N4C(=O)CCC4=O)cc3)s2)c1 |
| InChI | InChI=1S/C20H18N4O4S3/c1-13-3-2-4-14(11-13)12-29-20-22-21-19(30-20)23-31(27,28)16-7-5-15(6-8-16)24-17(25)9-10-18(24)26/h2-8,11H,9-10,12H2,1H3,(H,21,23) |
| InChIKey | SVSZGWISBAVSQU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|