C31H26Cl2N2O6 — CID 10054191
[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[3-(2,4-dichlorophenyl)propoxy]acetate (PubChem CID 10054191) has the molecular formula C31H26Cl2N2O6 and a molecular weight of 593.46 g/mol. Its IUPAC name is [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[3-(2,4-dichlorophenyl)propoxy]acetate.
| Compound Name | [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[3-(2,4-dichlorophenyl)propoxy]acetate |
|---|---|
| PubChem CID | 10054191 |
| Molecular Formula | C31H26Cl2N2O6 |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 2-[3-(2,4-dichlorophenyl)propoxy]acetate |
| SMILES | CC[C@@]1(OC(=O)COCCCc2ccc(Cl)cc2Cl)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C31H26Cl2N2O6/c1-2-31(41-27(36)17-39-11-5-7-18-9-10-21(32)13-24(18)33)23-14-26-28-20(12-19-6-3-4-8-25(19)34-28)15-35(26)29(37)22(23)16-40-30(31)38/h3-4,6,8-10,12-14H,2,5,7,11,15-17H2,1H3/t31-/m0/s1 |
| InChIKey | OYMNERVTAVMWFG-HKBQPEDESA-N |
| XLogP | 5.59 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|