C26H23N5O8 — CID 59492116
2-azidoethyl 2-[2-[[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl]oxy]-2-oxoethoxy]acetate (PubChem CID 59492116) has the molecular formula C26H23N5O8 and a molecular weight of 533.50 g/mol. Its IUPAC name is 2-azidoethyl 2-[2-[[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl]oxy]-2-oxoethoxy]acetate.
| Compound Name | 2-azidoethyl 2-[2-[[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl]oxy]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 59492116 |
| Molecular Formula | C26H23N5O8 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 2-azidoethyl 2-[2-[[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl]oxy]-2-oxoethoxy]acetate |
| SMILES | CC[C@@]1(OC(=O)COCC(=O)OCCN=[N+]=[N-])C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C26H23N5O8/c1-2-26(39-22(33)14-36-13-21(32)37-8-7-28-30-27)18-10-20-23-16(9-15-5-3-4-6-19(15)29-23)11-31(20)24(34)17(18)12-38-25(26)35/h3-6,9-10H,2,7-8,11-14H2,1H3/t26-/m0/s1 |
| InChIKey | QNGYHMCQIYQPCB-SANMLTNESA-N |
| XLogP | 2.50 |
| TPSA | 171.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|